C38H52N6O6 — CID 135095161
(4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-[3-(2-oxopiperidin-1-yl)propanoyl]-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135095161) has the molecular formula C38H52N6O6 and a molecular weight of 688.87 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-[3-(2-oxopiperidin-1-yl)propanoyl]-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-[3-(2-oxopiperidin-1-yl)propanoyl]-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135095161 |
| Molecular Formula | C38H52N6O6 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-[3-(2-oxopiperidin-1-yl)propanoyl]-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccc(cc2)CN(C(=O)CCN2CCCCC2=O)CCCCNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C38H52N6O6/c1-26(2)23-31-37(49)40-27(3)35(47)39-19-8-10-21-44(34(46)18-22-43-20-9-7-13-33(43)45)25-29-14-16-30(17-15-29)36(48)41-32(38(50)42-31)24-28-11-5-4-6-12-28/h4-6,11-12,14-17,26-27,31-32H,7-10,13,18-25H2,1-3H3,(H,39,47)(H,40,49)(H,41,48)(H,42,50)/t27-,31+,32-/m1/s1 |
| InChIKey | XNYFHCVKLAUMJU-RKVVATLDSA-N |
| XLogP | 2.70 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|