C33H45N5O6 — CID 135105913
(4R,7S,10R)-4-benzyl-17-[(2R)-2-hydroxypropanoyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135105913) has the molecular formula C33H45N5O6 and a molecular weight of 607.75 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-17-[(2R)-2-hydroxypropanoyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-17-[(2R)-2-hydroxypropanoyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135105913 |
| Molecular Formula | C33H45N5O6 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-17-[(2R)-2-hydroxypropanoyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccc(cc2)CN(C(=O)[C@@H](C)O)CCCCNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C33H45N5O6/c1-21(2)18-27-31(42)35-22(3)29(40)34-16-8-9-17-38(33(44)23(4)39)20-25-12-14-26(15-13-25)30(41)36-28(32(43)37-27)19-24-10-6-5-7-11-24/h5-7,10-15,21-23,27-28,39H,8-9,16-20H2,1-4H3,(H,34,40)(H,35,42)(H,36,41)(H,37,43)/t22-,23-,27+,28-/m1/s1 |
| InChIKey | WPCKHOGAJVXQRI-SFUJYVBYSA-N |
| XLogP | 1.68 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|