C36H43ClN6O5 — CID 135093981
(4R,7S,10R)-4-benzyl-17-(3-chloropyridine-4-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135093981) has the molecular formula C36H43ClN6O5 and a molecular weight of 675.23 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-17-(3-chloropyridine-4-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-17-(3-chloropyridine-4-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135093981 |
| Molecular Formula | C36H43ClN6O5 |
| Molecular Weight | 675.23 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-17-(3-chloropyridine-4-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccc(cc2)CN(C(=O)c2ccncc2Cl)CCCCNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C36H43ClN6O5/c1-23(2)19-30-34(46)40-24(3)32(44)39-16-7-8-18-43(36(48)28-15-17-38-21-29(28)37)22-26-11-13-27(14-12-26)33(45)41-31(35(47)42-30)20-25-9-5-4-6-10-25/h4-6,9-15,17,21,23-24,30-31H,7-8,16,18-20,22H2,1-3H3,(H,39,44)(H,40,46)(H,41,45)(H,42,47)/t24-,30+,31-/m1/s1 |
| InChIKey | PLFAHHNQHAIKOC-XGJRVREISA-N |
| XLogP | 3.66 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|