C35H48N8O4 — CID 135117757
(4R,7S,10R)-4-benzyl-17-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135117757) has the molecular formula C35H48N8O4 and a molecular weight of 644.82 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-17-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-17-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135117757 |
| Molecular Formula | C35H48N8O4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-17-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | CCn1ncnc1CN1CCCCNC(=O)[C@@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccc(cc2)C1 |
| InChI | InChI=1S/C35H48N8O4/c1-5-43-31(37-23-38-43)22-42-18-10-9-17-36-32(44)25(4)39-34(46)29(19-24(2)3)41-35(47)30(20-26-11-7-6-8-12-26)40-33(45)28-15-13-27(21-42)14-16-28/h6-8,11-16,23-25,29-30H,5,9-10,17-22H2,1-4H3,(H,36,44)(H,39,46)(H,40,45)(H,41,47)/t25-,29+,30-/m1/s1 |
| InChIKey | HHWDKBTVZJTOTF-TZFWCWEWSA-N |
| XLogP | 2.59 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|