C35H41N7O6 — CID 137335711
(4R,7R,10R)-10-benzyl-4-methyl-15-(1-methylindole-3-carbonyl)-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone (PubChem CID 137335711) has the molecular formula C35H41N7O6 and a molecular weight of 655.76 g/mol. Its IUPAC name is (4R,7R,10R)-10-benzyl-4-methyl-15-(1-methylindole-3-carbonyl)-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone.
| Compound Name | (4R,7R,10R)-10-benzyl-4-methyl-15-(1-methylindole-3-carbonyl)-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 137335711 |
| Molecular Formula | C35H41N7O6 |
| Molecular Weight | 655.76 g/mol |
| Exact Mass | 655.31 |
| IUPAC Name | (4R,7R,10R)-10-benzyl-4-methyl-15-(1-methylindole-3-carbonyl)-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)NC(=O)c2cc(on2)CN(C(=O)c2cn(C)c3ccccc23)CCNC(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C35H41N7O6/c1-21(2)16-27-33(45)39-28(17-23-10-6-5-7-11-23)32(44)36-14-15-42(35(47)26-20-41(4)30-13-9-8-12-25(26)30)19-24-18-29(40-48-24)34(46)37-22(3)31(43)38-27/h5-13,18,20-22,27-28H,14-17,19H2,1-4H3,(H,36,44)(H,37,46)(H,38,43)(H,39,45)/t22-,27-,28-/m1/s1 |
| InChIKey | BFNOWHQCIVNUMH-MWVDVNALSA-N |
| XLogP | 2.32 |
| TPSA | 167.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |