C34H41N7O7 — CID 137336776
(4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-morpholin-4-yl-2-oxoethyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone (PubChem CID 137336776) has the molecular formula C34H41N7O7 and a molecular weight of 659.74 g/mol. Its IUPAC name is (4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-morpholin-4-yl-2-oxoethyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone.
| Compound Name | (4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-morpholin-4-yl-2-oxoethyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 137336776 |
| Molecular Formula | C34H41N7O7 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | (4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-morpholin-4-yl-2-oxoethyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
| SMILES | C[C@@H]1NC(=O)c2cc(on2)CN(CC(=O)N2CCOCC2)CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C34H41N7O7/c1-23-31(43)37-28(19-25-10-6-3-7-11-25)33(45)38-27(18-24-8-4-2-5-9-24)32(44)35-12-13-40(22-30(42)41-14-16-47-17-15-41)21-26-20-29(39-48-26)34(46)36-23/h2-11,20,23,27-28H,12-19,21-22H2,1H3,(H,35,44)(H,36,46)(H,37,43)(H,38,45)/t23-,27+,28-/m0/s1 |
| InChIKey | BMRTWYNEVXQHBA-LBNPDIFZSA-N |
| XLogP | 0.04 |
| TPSA | 175.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |