C31H36N6O7 — CID 137340309
(4S,7S,10R)-7,10-dibenzyl-15-(2-methoxyacetyl)-4-methyl-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone (PubChem CID 137340309) has the molecular formula C31H36N6O7 and a molecular weight of 604.66 g/mol. Its IUPAC name is (4S,7S,10R)-7,10-dibenzyl-15-(2-methoxyacetyl)-4-methyl-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone.
| Compound Name | (4S,7S,10R)-7,10-dibenzyl-15-(2-methoxyacetyl)-4-methyl-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 137340309 |
| Molecular Formula | C31H36N6O7 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | (4S,7S,10R)-7,10-dibenzyl-15-(2-methoxyacetyl)-4-methyl-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
| SMILES | COCC(=O)N1CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C)NC(=O)c2cc(on2)C1 |
| InChI | InChI=1S/C31H36N6O7/c1-20-28(39)34-25(16-22-11-7-4-8-12-22)30(41)35-24(15-21-9-5-3-6-10-21)29(40)32-13-14-37(27(38)19-43-2)18-23-17-26(36-44-23)31(42)33-20/h3-12,17,20,24-25H,13-16,18-19H2,1-2H3,(H,32,40)(H,33,42)(H,34,39)(H,35,41)/t20-,24+,25-/m0/s1 |
| InChIKey | QLUKQEGHEOIAOB-AMDXRBSFSA-N |
| XLogP | 0.35 |
| TPSA | 171.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |