C28H38N6O7 — CID 137340831
(4R,7R,10R)-10-benzyl-15-(2-methoxyacetyl)-4-methyl-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone (PubChem CID 137340831) has the molecular formula C28H38N6O7 and a molecular weight of 570.65 g/mol. Its IUPAC name is (4R,7R,10R)-10-benzyl-15-(2-methoxyacetyl)-4-methyl-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone.
| Compound Name | (4R,7R,10R)-10-benzyl-15-(2-methoxyacetyl)-4-methyl-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 137340831 |
| Molecular Formula | C28H38N6O7 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | (4R,7R,10R)-10-benzyl-15-(2-methoxyacetyl)-4-methyl-7-(2-methylpropyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
| SMILES | COCC(=O)N1CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C)NC(=O)c2cc(on2)C1 |
| InChI | InChI=1S/C28H38N6O7/c1-17(2)12-21-27(38)32-22(13-19-8-6-5-7-9-19)26(37)29-10-11-34(24(35)16-40-4)15-20-14-23(33-41-20)28(39)30-18(3)25(36)31-21/h5-9,14,17-18,21-22H,10-13,15-16H2,1-4H3,(H,29,37)(H,30,39)(H,31,36)(H,32,38)/t18-,21-,22-/m1/s1 |
| InChIKey | PJJOVZZGTNQCHF-STZQEDGTSA-N |
| XLogP | 0.16 |
| TPSA | 171.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |