C30H38N6O6 — CID 154820079
(2R,15S)-15-benzyl-10-(3-methylbutanoyl)-2-(2-methylpropyl)-7,20-dioxa-3,6,10,13,16,21-hexazatricyclo[16.2.1.15,8]docosa-1(21),5,8(22),18-tetraene-4,14,17-trione (PubChem CID 154820079) has the molecular formula C30H38N6O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is (2R,15S)-15-benzyl-10-(3-methylbutanoyl)-2-(2-methylpropyl)-7,20-dioxa-3,6,10,13,16,21-hexazatricyclo[16.2.1.15,8]docosa-1(21),5,8(22),18-tetraene-4,14,17-trione.
| Compound Name | (2R,15S)-15-benzyl-10-(3-methylbutanoyl)-2-(2-methylpropyl)-7,20-dioxa-3,6,10,13,16,21-hexazatricyclo[16.2.1.15,8]docosa-1(21),5,8(22),18-tetraene-4,14,17-trione |
|---|---|
| PubChem CID | 154820079 |
| Molecular Formula | C30H38N6O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | (2R,15S)-15-benzyl-10-(3-methylbutanoyl)-2-(2-methylpropyl)-7,20-dioxa-3,6,10,13,16,21-hexazatricyclo[16.2.1.15,8]docosa-1(21),5,8(22),18-tetraene-4,14,17-trione |
| SMILES | CC(C)CC(=O)N1CCNC(=O)[C@H](Cc2ccccc2)NC(=O)c2coc(n2)[C@@H](CC(C)C)NC(=O)c2cc(on2)C1 |
| InChI | InChI=1S/C30H38N6O6/c1-18(2)12-24-30-34-25(17-41-30)29(40)32-22(14-20-8-6-5-7-9-20)27(38)31-10-11-36(26(37)13-19(3)4)16-21-15-23(35-42-21)28(39)33-24/h5-9,15,17-19,22,24H,10-14,16H2,1-4H3,(H,31,38)(H,32,40)(H,33,39)/t22-,24+/m0/s1 |
| InChIKey | FRMFYDQGLLTPKT-LADGPHEKSA-N |
| XLogP | 3.03 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |