C35H43N7O6 — CID 137342952
(4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-piperidin-1-ylacetyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone (PubChem CID 137342952) has the molecular formula C35H43N7O6 and a molecular weight of 657.77 g/mol. Its IUPAC name is (4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-piperidin-1-ylacetyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone.
| Compound Name | (4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-piperidin-1-ylacetyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 137342952 |
| Molecular Formula | C35H43N7O6 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | (4S,7S,10R)-7,10-dibenzyl-4-methyl-15-(2-piperidin-1-ylacetyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
| SMILES | C[C@@H]1NC(=O)c2cc(on2)CN(C(=O)CN2CCCCC2)CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C35H43N7O6/c1-24-32(44)38-29(20-26-13-7-3-8-14-26)34(46)39-28(19-25-11-5-2-6-12-25)33(45)36-15-18-42(31(43)23-41-16-9-4-10-17-41)22-27-21-30(40-48-27)35(47)37-24/h2-3,5-8,11-14,21,24,28-29H,4,9-10,15-20,22-23H2,1H3,(H,36,45)(H,37,47)(H,38,44)(H,39,46)/t24-,28+,29-/m0/s1 |
| InChIKey | HWGWLWBJCCPERE-DOUMQJFESA-N |
| XLogP | 1.19 |
| TPSA | 165.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |