C30H37N7O6 — CID 137337579
(4R,7R,10R)-10-benzyl-4-methyl-7-(2-methylpropyl)-15-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone (PubChem CID 137337579) has the molecular formula C30H37N7O6 and a molecular weight of 591.67 g/mol. Its IUPAC name is (4R,7R,10R)-10-benzyl-4-methyl-7-(2-methylpropyl)-15-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone.
| Compound Name | (4R,7R,10R)-10-benzyl-4-methyl-7-(2-methylpropyl)-15-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 137337579 |
| Molecular Formula | C30H37N7O6 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (4R,7R,10R)-10-benzyl-4-methyl-7-(2-methylpropyl)-15-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,15,19-hexazabicyclo[15.2.1]icosa-1(19),17(20)-diene-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)NC(=O)c2cc(on2)CN(C(=O)c2cc[nH]c2)CCNC(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C30H37N7O6/c1-18(2)13-23-28(40)35-24(14-20-7-5-4-6-8-20)27(39)32-11-12-37(30(42)21-9-10-31-16-21)17-22-15-25(36-43-22)29(41)33-19(3)26(38)34-23/h4-10,15-16,18-19,23-24,31H,11-14,17H2,1-3H3,(H,32,39)(H,33,41)(H,34,38)(H,35,40)/t19-,23-,24-/m1/s1 |
| InChIKey | PMNGYEYLCSZBSN-CTUHWIOQSA-N |
| XLogP | 1.15 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |