C36H38N6O6 — CID 11262282
(3S,9R,12S,15S)-9-benzyl-3-[(4-hydroxyphenyl)methyl]-12-(1H-indol-3-ylmethyl)-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone (PubChem CID 11262282) has the molecular formula C36H38N6O6 and a molecular weight of 650.74 g/mol. Its IUPAC name is (3S,9R,12S,15S)-9-benzyl-3-[(4-hydroxyphenyl)methyl]-12-(1H-indol-3-ylmethyl)-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,9R,12S,15S)-9-benzyl-3-[(4-hydroxyphenyl)methyl]-12-(1H-indol-3-ylmethyl)-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 11262282 |
| Molecular Formula | C36H38N6O6 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | (3S,9R,12S,15S)-9-benzyl-3-[(4-hydroxyphenyl)methyl]-12-(1H-indol-3-ylmethyl)-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone |
| SMILES | O=C1CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccc(O)cc2)N1 |
| InChI | InChI=1S/C36H38N6O6/c43-25-14-12-23(13-15-25)18-30-36(48)42-16-6-11-31(42)35(47)41-29(19-24-20-37-27-10-5-4-9-26(24)27)34(46)40-28(17-22-7-2-1-3-8-22)33(45)38-21-32(44)39-30/h1-5,7-10,12-15,20,28-31,37,43H,6,11,16-19,21H2,(H,38,45)(H,39,44)(H,40,46)(H,41,47)/t28-,29+,30+,31+/m1/s1 |
| InChIKey | NJUMCCHBXOYZBO-BHSUFKTOSA-N |
| XLogP | 1.48 |
| TPSA | 172.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |