C34H37N5O4 — CID 139382824
(3R,6S,9R,12R)-3,9-dibenzyl-5-hydroxy-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,8,11-trione (PubChem CID 139382824) has the molecular formula C34H37N5O4 and a molecular weight of 579.70 g/mol. Its IUPAC name is (3R,6S,9R,12R)-3,9-dibenzyl-5-hydroxy-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,8,11-trione.
| Compound Name | (3R,6S,9R,12R)-3,9-dibenzyl-5-hydroxy-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,8,11-trione |
|---|---|
| PubChem CID | 139382824 |
| Molecular Formula | C34H37N5O4 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | (3R,6S,9R,12R)-3,9-dibenzyl-5-hydroxy-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,8,11-trione |
| SMILES | O=C1N[C@H](Cc2ccccc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(O)N[C@H](Cc2ccccc2)C(=O)N2CCC[C@H]12 |
| InChI | InChI=1S/C34H37N5O4/c40-31-27(18-22-10-3-1-4-11-22)37-33(42)30-16-9-17-39(30)34(43)29(19-23-12-5-2-6-13-23)38-32(41)28(36-31)20-24-21-35-26-15-8-7-14-25(24)26/h1-8,10-15,21,27-30,32,35,38,41H,9,16-20H2,(H,36,40)(H,37,42)/t27-,28+,29-,30-,32?/m1/s1 |
| InChIKey | VKERSXDFALLIHC-JAWCRCLCSA-N |
| XLogP | 2.45 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |