C34H40N6O7 — CID 139584656
N-[(3R,6R,9S,10R,13S,16S)-6-benzyl-13-(1H-indol-3-ylmethyl)-3,10-dimethyl-2,5,8,12,15-pentaoxo-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-9-yl]acetamide (PubChem CID 139584656) has the molecular formula C34H40N6O7 and a molecular weight of 644.73 g/mol. Its IUPAC name is N-[(3R,6R,9S,10R,13S,16S)-6-benzyl-13-(1H-indol-3-ylmethyl)-3,10-dimethyl-2,5,8,12,15-pentaoxo-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-9-yl]acetamide.
| Compound Name | N-[(3R,6R,9S,10R,13S,16S)-6-benzyl-13-(1H-indol-3-ylmethyl)-3,10-dimethyl-2,5,8,12,15-pentaoxo-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-9-yl]acetamide |
|---|---|
| PubChem CID | 139584656 |
| Molecular Formula | C34H40N6O7 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | N-[(3R,6R,9S,10R,13S,16S)-6-benzyl-13-(1H-indol-3-ylmethyl)-3,10-dimethyl-2,5,8,12,15-pentaoxo-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-9-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(=O)N[C@H](Cc2ccccc2)C(=O)N[C@H](C)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C34H40N6O7/c1-19-33(45)40-15-9-14-28(40)31(43)39-27(17-23-18-35-25-13-8-7-12-24(23)25)34(46)47-20(2)29(37-21(3)41)32(44)38-26(30(42)36-19)16-22-10-5-4-6-11-22/h4-8,10-13,18-20,26-29,35H,9,14-17H2,1-3H3,(H,36,42)(H,37,41)(H,38,44)(H,39,43)/t19-,20-,26-,27+,28+,29+/m1/s1 |
| InChIKey | IACBOWBNBXRQFN-PKYHHUKHSA-N |
| XLogP | 0.87 |
| TPSA | 178.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |