C39H47N7O4 — CID 118464591
(2S)-6-amino-2-[(3S)-3-benzyl-4-[(2S)-2-[(3S)-3-benzyl-2-oxopiperazin-1-yl]-3-(1H-indol-3-yl)propanoyl]-2-oxopiperazin-1-yl]hexanamide (PubChem CID 118464591) has the molecular formula C39H47N7O4 and a molecular weight of 677.85 g/mol. Its IUPAC name is (2S)-6-amino-2-[(3S)-3-benzyl-4-[(2S)-2-[(3S)-3-benzyl-2-oxopiperazin-1-yl]-3-(1H-indol-3-yl)propanoyl]-2-oxopiperazin-1-yl]hexanamide.
| Compound Name | (2S)-6-amino-2-[(3S)-3-benzyl-4-[(2S)-2-[(3S)-3-benzyl-2-oxopiperazin-1-yl]-3-(1H-indol-3-yl)propanoyl]-2-oxopiperazin-1-yl]hexanamide |
|---|---|
| PubChem CID | 118464591 |
| Molecular Formula | C39H47N7O4 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.37 |
| IUPAC Name | (2S)-6-amino-2-[(3S)-3-benzyl-4-[(2S)-2-[(3S)-3-benzyl-2-oxopiperazin-1-yl]-3-(1H-indol-3-yl)propanoyl]-2-oxopiperazin-1-yl]hexanamide |
| SMILES | NCCCCC(C(N)=O)N1CCN(C(=O)[C@H](Cc2c[nH]c3ccccc23)N2CCN[C@@H](Cc3ccccc3)C2=O)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C39H47N7O4/c40-18-10-9-17-33(36(41)47)45-21-22-46(34(38(45)49)24-28-13-5-2-6-14-28)39(50)35(25-29-26-43-31-16-8-7-15-30(29)31)44-20-19-42-32(37(44)48)23-27-11-3-1-4-12-27/h1-8,11-16,26,32-35,42-43H,9-10,17-25,40H2,(H2,41,47)/t32-,33?,34-,35-/m0/s1 |
| InChIKey | QGHPGQRUEHNQIH-GONGHQDWSA-N |
| XLogP | 2.39 |
| TPSA | 157.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|