C13H12N2O2 — CID 82376842
2-benzyl-2,4-dihydro-1H-furo[3,4-b]pyrazin-3-one (PubChem CID 82376842) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-benzyl-2,4-dihydro-1H-furo[3,4-b]pyrazin-3-one.
| Compound Name | 2-benzyl-2,4-dihydro-1H-furo[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 82376842 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-benzyl-2,4-dihydro-1H-furo[3,4-b]pyrazin-3-one |
| SMILES | O=C1Nc2cocc2NC1Cc1ccccc1 |
| InChI | InChI=1S/C13H12N2O2/c16-13-10(6-9-4-2-1-3-5-9)14-11-7-17-8-12(11)15-13/h1-5,7-8,10,14H,6H2,(H,15,16) |
| InChIKey | FCTQVBVMUCFBIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |