C28H30O8 — CID 10255177
ethyl (3aS,3bS,6R,6aS,7R,7aR)-7-hydroxy-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate (PubChem CID 10255177) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is ethyl (3aS,3bS,6R,6aS,7R,7aR)-7-hydroxy-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate.
| Compound Name | ethyl (3aS,3bS,6R,6aS,7R,7aR)-7-hydroxy-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 10255177 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | ethyl (3aS,3bS,6R,6aS,7R,7aR)-7-hydroxy-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(=O)c2ccc(OCc3ccccc3)cc2)[C@@H]2[C@@H](O)[C@H]3OC(C)(C)O[C@H]3[C@H]12 |
| InChI | InChI=1S/C28H30O8/c1-4-32-27(31)19-14-20(22-21(19)24-25(23(22)29)36-28(2,3)35-24)34-26(30)17-10-12-18(13-11-17)33-15-16-8-6-5-7-9-16/h5-14,20-25,29H,4,15H2,1-3H3/t20-,21-,22+,23-,24+,25-/m1/s1 |
| InChIKey | FDORBNCSELAYEQ-QCPNHMKVSA-N |
| XLogP | 3.42 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |