C28H30O7 — CID 10096615
ethyl (3aS,3bS,6S,6aR,7aR)-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate (PubChem CID 10096615) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is ethyl (3aS,3bS,6S,6aR,7aR)-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate.
| Compound Name | ethyl (3aS,3bS,6S,6aR,7aR)-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 10096615 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | ethyl (3aS,3bS,6S,6aR,7aR)-2,2-dimethyl-6-(4-phenylmethoxybenzoyl)oxy-3a,3b,6,6a,7,7a-hexahydropentaleno[1,2-d][1,3]dioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(=O)c2ccc(OCc3ccccc3)cc2)[C@@H]2C[C@H]3OC(C)(C)O[C@H]3[C@H]12 |
| InChI | InChI=1S/C28H30O7/c1-4-31-27(30)21-15-22(20-14-23-25(24(20)21)35-28(2,3)34-23)33-26(29)18-10-12-19(13-11-18)32-16-17-8-6-5-7-9-17/h5-13,15,20,22-25H,4,14,16H2,1-3H3/t20-,22+,23+,24-,25+/m0/s1 |
| InChIKey | DAEDZJOZZDKSJH-DDBGIMTGSA-N |
| XLogP | 4.45 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |