C28H30O8 — CID 10255178
[(1R,2S,6R,8R,9S,10R,12R)-12-(acetyloxymethyl)-4,4-dimethyl-3,5,11-trioxatetracyclo[6.4.0.02,6.010,12]dodecan-9-yl] 4-phenylmethoxybenzoate (PubChem CID 10255178) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is [(1R,2S,6R,8R,9S,10R,12R)-12-(acetyloxymethyl)-4,4-dimethyl-3,5,11-trioxatetracyclo[6.4.0.02,6.010,12]dodecan-9-yl] 4-phenylmethoxybenzoate.
| Compound Name | [(1R,2S,6R,8R,9S,10R,12R)-12-(acetyloxymethyl)-4,4-dimethyl-3,5,11-trioxatetracyclo[6.4.0.02,6.010,12]dodecan-9-yl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 10255178 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [(1R,2S,6R,8R,9S,10R,12R)-12-(acetyloxymethyl)-4,4-dimethyl-3,5,11-trioxatetracyclo[6.4.0.02,6.010,12]dodecan-9-yl] 4-phenylmethoxybenzoate |
| SMILES | CC(=O)OC[C@@]12O[C@@H]1[C@@H](OC(=O)c1ccc(OCc3ccccc3)cc1)[C@@H]1C[C@H]3OC(C)(C)O[C@H]3[C@@H]12 |
| InChI | InChI=1S/C28H30O8/c1-16(29)32-15-28-22-20(13-21-24(22)35-27(2,3)34-21)23(25(28)36-28)33-26(30)18-9-11-19(12-10-18)31-14-17-7-5-4-6-8-17/h4-12,20-25H,13-15H2,1-3H3/t20-,21-,22-,23+,24-,25-,28+/m1/s1 |
| InChIKey | ZLWBEYKDVDJFMX-HQEWOGIFSA-N |
| XLogP | 3.66 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|