C31H37NO9 — CID 154718177
[(1S,2R,6R,7S,8S,9S,10R,12S,13R)-9-acetyloxy-8-amino-4,4-dimethyl-7-phenylmethoxy-12-(phenylmethoxymethyl)-3,5,11-trioxatetracyclo[6.5.0.02,6.010,12]tridecan-13-yl] acetate (PubChem CID 154718177) has the molecular formula C31H37NO9 and a molecular weight of 567.64 g/mol. Its IUPAC name is [(1S,2R,6R,7S,8S,9S,10R,12S,13R)-9-acetyloxy-8-amino-4,4-dimethyl-7-phenylmethoxy-12-(phenylmethoxymethyl)-3,5,11-trioxatetracyclo[6.5.0.02,6.010,12]tridecan-13-yl] acetate.
| Compound Name | [(1S,2R,6R,7S,8S,9S,10R,12S,13R)-9-acetyloxy-8-amino-4,4-dimethyl-7-phenylmethoxy-12-(phenylmethoxymethyl)-3,5,11-trioxatetracyclo[6.5.0.02,6.010,12]tridecan-13-yl] acetate |
|---|---|
| PubChem CID | 154718177 |
| Molecular Formula | C31H37NO9 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | [(1S,2R,6R,7S,8S,9S,10R,12S,13R)-9-acetyloxy-8-amino-4,4-dimethyl-7-phenylmethoxy-12-(phenylmethoxymethyl)-3,5,11-trioxatetracyclo[6.5.0.02,6.010,12]tridecan-13-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H]3OC(C)(C)O[C@H]3[C@@H](OCc3ccccc3)[C@]2(N)[C@H](OC(C)=O)[C@H]2O[C@@]12COCc1ccccc1 |
| InChI | InChI=1S/C31H37NO9/c1-18(33)37-25-22-23-24(40-29(3,4)39-23)26(36-16-21-13-9-6-10-14-21)31(22,32)28(38-19(2)34)27-30(25,41-27)17-35-15-20-11-7-5-8-12-20/h5-14,22-28H,15-17,32H2,1-4H3/t22-,23+,24+,25+,26+,27+,28+,30-,31-/m0/s1 |
| InChIKey | KOYPUFXLRGJTSD-WFKCWWMRSA-N |
| XLogP | 2.65 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|