C19H26O7 — CID 10893889
[(3aR,4R,6S,6aS)-4-ethoxy-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate (PubChem CID 10893889) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-4-ethoxy-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,4R,6S,6aS)-4-ethoxy-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 10893889 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(3aR,4R,6S,6aS)-4-ethoxy-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate |
| SMILES | CCO[C@]1(COCc2ccccc2)O[C@@H](OC(C)=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C19H26O7/c1-5-22-19(12-21-11-14-9-7-6-8-10-14)16-15(24-18(3,4)25-16)17(26-19)23-13(2)20/h6-10,15-17H,5,11-12H2,1-4H3/t15-,16+,17+,19+/m0/s1 |
| InChIKey | CWHHZQXIHBEFTC-DODZYUBVSA-N |
| XLogP | 2.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |