C29H30O6 — CID 90177933
[(3aS,5R,6R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[4-methyl-3-[(4-phenylmethoxyphenyl)methyl]phenyl]methanone (PubChem CID 90177933) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(3aS,5R,6R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[4-methyl-3-[(4-phenylmethoxyphenyl)methyl]phenyl]methanone.
| Compound Name | [(3aS,5R,6R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[4-methyl-3-[(4-phenylmethoxyphenyl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 90177933 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [(3aS,5R,6R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[4-methyl-3-[(4-phenylmethoxyphenyl)methyl]phenyl]methanone |
| SMILES | Cc1ccc(C(=O)[C@@H]2O[C@H]3OC(C)(C)O[C@H]3[C@H]2O)cc1Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H30O6/c1-18-9-12-21(24(30)26-25(31)27-28(33-26)35-29(2,3)34-27)16-22(18)15-19-10-13-23(14-11-19)32-17-20-7-5-4-6-8-20/h4-14,16,25-28,31H,15,17H2,1-3H3/t25-,26-,27-,28-/m0/s1 |
| InChIKey | IGRPAUFWDSZGEK-LJWNLINESA-N |
| XLogP | 4.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |