C30H31NO5 — CID 89279337
[3-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate (PubChem CID 89279337) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is [3-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate.
| Compound Name | [3-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 89279337 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [3-[4-(N-(4-methoxyphenyl)anilino)phenyl]-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(c1ccc(N(c2ccccc2)c2ccc(OC)cc2)cc1)C(C)OC(=O)C=C |
| InChI | InChI=1S/C30H31NO5/c1-6-28(32)35-21(3)30(22(4)36-29(33)7-2)23-13-15-25(16-14-23)31(24-11-9-8-10-12-24)26-17-19-27(34-5)20-18-26/h6-22,30H,1-2H2,3-5H3 |
| InChIKey | GZKCJWHTRRQXQM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|