C27H34N2O3 — CID 18647381
2-[4-[4-[(2R)-2-ethoxypropoxy]phenyl]phenyl]-5-hexoxypyrimidine (PubChem CID 18647381) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[4-[4-[(2R)-2-ethoxypropoxy]phenyl]phenyl]-5-hexoxypyrimidine.
| Compound Name | 2-[4-[4-[(2R)-2-ethoxypropoxy]phenyl]phenyl]-5-hexoxypyrimidine |
|---|---|
| PubChem CID | 18647381 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2-[4-[4-[(2R)-2-ethoxypropoxy]phenyl]phenyl]-5-hexoxypyrimidine |
| SMILES | CCCCCCOc1cnc(-c2ccc(-c3ccc(OC[C@@H](C)OCC)cc3)cc2)nc1 |
| InChI | InChI=1S/C27H34N2O3/c1-4-6-7-8-17-31-26-18-28-27(29-19-26)24-11-9-22(10-12-24)23-13-15-25(16-14-23)32-20-21(3)30-5-2/h9-16,18-19,21H,4-8,17,20H2,1-3H3/t21-/m1/s1 |
| InChIKey | SHOIQBWAARXSOG-OAQYLSRUSA-N |
| XLogP | 6.57 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|