C28H39F3N2O5 — CID 22913386
[1,1,1-trifluoro-3-[2-(4-octoxyphenyl)pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate (PubChem CID 22913386) has the molecular formula C28H39F3N2O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[2-(4-octoxyphenyl)pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate.
| Compound Name | [1,1,1-trifluoro-3-[2-(4-octoxyphenyl)pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate |
|---|---|
| PubChem CID | 22913386 |
| Molecular Formula | C28H39F3N2O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | [1,1,1-trifluoro-3-[2-(4-octoxyphenyl)pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(OCC(OC(=O)C(C)OCCCC)C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C28H39F3N2O5/c1-4-6-8-9-10-11-17-36-23-14-12-22(13-15-23)26-32-18-24(19-33-26)37-20-25(28(29,30)31)38-27(34)21(3)35-16-7-5-2/h12-15,18-19,21,25H,4-11,16-17,20H2,1-3H3 |
| InChIKey | JAZBXCGBTOHKFH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|