About bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene
bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene (PubChem CID 175862088) has the molecular formula C22H34O10S2
and a molecular weight of 522.64 g/mol. Its IUPAC name is bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene.
Molecular Properties
| Compound Name | bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene |
| PubChem CID | 175862088 |
| Molecular Formula | C22H34O10S2 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene |
| SMILES | CCCCCC(Oc1ccccc1)Oc1ccccc1.O=S(=O)(O)CCO.O=S(=O)(O)CCO |
| InChI | InChI=1S/C18H22O2.2C2H6O4S/c1-2-3-6-15-18(19-16-11-7-4-8-12-16)20-17-13-9-5-10-14-17;2*3-1-2-7(4,5)6/h4-5,7-14,18H,2-3,6,15H2,1H3;2*3H,1-2H2,(H,4,5,6) |
| InChIKey | JDUDQYQGKSQAHD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene?
The IUPAC name of bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene (CID 175862088) is bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene.
What is the SMILES notation for bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene?
The canonical SMILES for bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene is CCCCCC(Oc1ccccc1)Oc1ccccc1.O=S(=O)(O)CCO.O=S(=O)(O)CCO.
What is the InChIKey of bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene?
The InChIKey is JDUDQYQGKSQAHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2.2C2H6O4S/c1-2-3-6-15-18(19-16-11-7-4-8-12-16)20-17-13-9-5-10-14-17;2*3-1-2-7(4,5)6/h4-5,7-14,18H,2-3,6,15H2,1H3;2*3H,1-2H2,(H,4,5,6).
What are the key properties of bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene?
bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene has a molecular weight of 522.64 g/mol, XLogP of 2.78, 12 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethanesulfonic acid);1-phenoxyhexoxybenzene is sourced from PubChem (CID 175862088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).