C14H22O — CID 10655951
[(3S,4S)-4-deuteriooctan-3-yl]oxybenzene (PubChem CID 10655951) has the molecular formula C14H22O and a molecular weight of 207.34 g/mol. Its IUPAC name is [(3S,4S)-4-deuteriooctan-3-yl]oxybenzene.
| Compound Name | [(3S,4S)-4-deuteriooctan-3-yl]oxybenzene |
|---|---|
| PubChem CID | 10655951 |
| Molecular Formula | C14H22O |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | [(3S,4S)-4-deuteriooctan-3-yl]oxybenzene |
| SMILES | [2H][C@@H](CCCC)[C@H](CC)Oc1ccccc1 |
| InChI | InChI=1S/C14H22O/c1-3-5-7-10-13(4-2)15-14-11-8-6-9-12-14/h6,8-9,11-13H,3-5,7,10H2,1-2H3/t13-/m0/s1/i10D/t10-,13- |
| InChIKey | OWXJRJFOTZCIBG-GVTKCWFASA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |