About hex-5-en-3-yloxybenzene
hex-5-en-3-yloxybenzene (PubChem CID 174866865) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is hex-5-en-3-yloxybenzene.
Molecular Properties
| Compound Name | hex-5-en-3-yloxybenzene |
| PubChem CID | 174866865 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | hex-5-en-3-yloxybenzene |
| SMILES | C=CCC(CC)Oc1ccccc1 |
| InChI | InChI=1S/C12H16O/c1-3-8-11(4-2)13-12-9-6-5-7-10-12/h3,5-7,9-11H,1,4,8H2,2H3 |
| InChIKey | LVCIHPKYTJHFFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-en-3-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-en-3-yloxybenzene?
The IUPAC name of hex-5-en-3-yloxybenzene (CID 174866865) is hex-5-en-3-yloxybenzene.
What is the SMILES notation for hex-5-en-3-yloxybenzene?
The canonical SMILES for hex-5-en-3-yloxybenzene is C=CCC(CC)Oc1ccccc1.
What is the InChIKey of hex-5-en-3-yloxybenzene?
The InChIKey is LVCIHPKYTJHFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-3-8-11(4-2)13-12-9-6-5-7-10-12/h3,5-7,9-11H,1,4,8H2,2H3.
What are the key properties of hex-5-en-3-yloxybenzene?
hex-5-en-3-yloxybenzene has a molecular weight of 176.26 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-en-3-yloxybenzene is sourced from PubChem (CID 174866865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).