About 1-ethenoxypropoxybenzene
1-ethenoxypropoxybenzene (PubChem CID 20548165) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-ethenoxypropoxybenzene.
Molecular Properties
| Compound Name | 1-ethenoxypropoxybenzene |
| PubChem CID | 20548165 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-ethenoxypropoxybenzene |
| SMILES | C=COC(CC)Oc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-3-11(12-4-2)13-10-8-6-5-7-9-10/h4-9,11H,2-3H2,1H3 |
| InChIKey | XEBRFEJQYRKOPP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxypropoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxypropoxybenzene?
The IUPAC name of 1-ethenoxypropoxybenzene (CID 20548165) is 1-ethenoxypropoxybenzene.
What is the SMILES notation for 1-ethenoxypropoxybenzene?
The canonical SMILES for 1-ethenoxypropoxybenzene is C=COC(CC)Oc1ccccc1.
What is the InChIKey of 1-ethenoxypropoxybenzene?
The InChIKey is XEBRFEJQYRKOPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-3-11(12-4-2)13-10-8-6-5-7-9-10/h4-9,11H,2-3H2,1H3.
What are the key properties of 1-ethenoxypropoxybenzene?
1-ethenoxypropoxybenzene has a molecular weight of 178.23 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxypropoxybenzene is sourced from PubChem (CID 20548165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).