About 3-decan-4-yloxyphenol
3-decan-4-yloxyphenol (PubChem CID 57284040) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-decan-4-yloxyphenol.
Molecular Properties
| Compound Name | 3-decan-4-yloxyphenol |
| PubChem CID | 57284040 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-decan-4-yloxyphenol |
| SMILES | CCCCCCC(CCC)Oc1cccc(O)c1 |
| InChI | InChI=1S/C16H26O2/c1-3-5-6-7-11-15(9-4-2)18-16-12-8-10-14(17)13-16/h8,10,12-13,15,17H,3-7,9,11H2,1-2H3 |
| InChIKey | ULUXVWBKHBTAMK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decan-4-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decan-4-yloxyphenol?
The IUPAC name of 3-decan-4-yloxyphenol (CID 57284040) is 3-decan-4-yloxyphenol.
What is the SMILES notation for 3-decan-4-yloxyphenol?
The canonical SMILES for 3-decan-4-yloxyphenol is CCCCCCC(CCC)Oc1cccc(O)c1.
What is the InChIKey of 3-decan-4-yloxyphenol?
The InChIKey is ULUXVWBKHBTAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-3-5-6-7-11-15(9-4-2)18-16-12-8-10-14(17)13-16/h8,10,12-13,15,17H,3-7,9,11H2,1-2H3.
What are the key properties of 3-decan-4-yloxyphenol?
3-decan-4-yloxyphenol has a molecular weight of 250.38 g/mol, XLogP of 4.91, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decan-4-yloxyphenol is sourced from PubChem (CID 57284040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).