About 3-octylperoxyphenol
3-octylperoxyphenol (PubChem CID 174622967) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-octylperoxyphenol.
Molecular Properties
| Compound Name | 3-octylperoxyphenol |
| PubChem CID | 174622967 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 3-octylperoxyphenol |
| SMILES | CCCCCCCCOOc1cccc(O)c1 |
| InChI | InChI=1S/C14H22O3/c1-2-3-4-5-6-7-11-16-17-14-10-8-9-13(15)12-14/h8-10,12,15H,2-7,11H2,1H3 |
| InChIKey | ZNIJENZFXSJMTH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-octylperoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octylperoxyphenol?
The IUPAC name of 3-octylperoxyphenol (CID 174622967) is 3-octylperoxyphenol.
What is the SMILES notation for 3-octylperoxyphenol?
The canonical SMILES for 3-octylperoxyphenol is CCCCCCCCOOc1cccc(O)c1.
What is the InChIKey of 3-octylperoxyphenol?
The InChIKey is ZNIJENZFXSJMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-2-3-4-5-6-7-11-16-17-14-10-8-9-13(15)12-14/h8-10,12,15H,2-7,11H2,1H3.
What are the key properties of 3-octylperoxyphenol?
3-octylperoxyphenol has a molecular weight of 238.33 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylperoxyphenol is sourced from PubChem (CID 174622967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).