About 3-chlorophenol;4-tetradecoxyphenol
3-chlorophenol;4-tetradecoxyphenol (PubChem CID 70365139) has the molecular formula C26H39ClO3
and a molecular weight of 435.05 g/mol. Its IUPAC name is 3-chlorophenol;4-tetradecoxyphenol.
Molecular Properties
| Compound Name | 3-chlorophenol;4-tetradecoxyphenol |
| PubChem CID | 70365139 |
| Molecular Formula | C26H39ClO3 |
| Molecular Weight | 435.05 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 3-chlorophenol;4-tetradecoxyphenol |
| SMILES | CCCCCCCCCCCCCCOc1ccc(O)cc1.Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H34O2.C6H5ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-22-20-16-14-19(21)15-17-20;7-5-2-1-3-6(8)4-5/h14-17,21H,2-13,18H2,1H3;1-4,8H |
| InChIKey | CHKKDJXFXDRCRW-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.05 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorophenol;4-tetradecoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorophenol;4-tetradecoxyphenol?
The IUPAC name of 3-chlorophenol;4-tetradecoxyphenol (CID 70365139) is 3-chlorophenol;4-tetradecoxyphenol.
What is the SMILES notation for 3-chlorophenol;4-tetradecoxyphenol?
The canonical SMILES for 3-chlorophenol;4-tetradecoxyphenol is CCCCCCCCCCCCCCOc1ccc(O)cc1.Oc1cccc(Cl)c1.
What is the InChIKey of 3-chlorophenol;4-tetradecoxyphenol?
The InChIKey is CHKKDJXFXDRCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2.C6H5ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-22-20-16-14-19(21)15-17-20;7-5-2-1-3-6(8)4-5/h14-17,21H,2-13,18H2,1H3;1-4,8H.
What are the key properties of 3-chlorophenol;4-tetradecoxyphenol?
3-chlorophenol;4-tetradecoxyphenol has a molecular weight of 435.05 g/mol, XLogP of 8.52, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorophenol;4-tetradecoxyphenol is sourced from PubChem (CID 70365139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).