C16H22I2O4 — CID 24832442
2-(2,4-diiodo-3-octoxyphenoxy)acetic acid (PubChem CID 24832442) has the molecular formula C16H22I2O4 and a molecular weight of 532.16 g/mol. Its IUPAC name is 2-(2,4-diiodo-3-octoxyphenoxy)acetic acid.
| Compound Name | 2-(2,4-diiodo-3-octoxyphenoxy)acetic acid |
|---|---|
| PubChem CID | 24832442 |
| Molecular Formula | C16H22I2O4 |
| Molecular Weight | 532.16 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | 2-(2,4-diiodo-3-octoxyphenoxy)acetic acid |
| SMILES | CCCCCCCCOc1c(I)ccc(OCC(=O)O)c1I |
| InChI | InChI=1S/C16H22I2O4/c1-2-3-4-5-6-7-10-21-16-12(17)8-9-13(15(16)18)22-11-14(19)20/h8-9H,2-7,10-11H2,1H3,(H,19,20) |
| InChIKey | GKKUOGHPILTIMB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|