C16H13Cl3O2 — CID 54299691
3,5-dichloro-4-[4-(4-chlorophenyl)but-3-enoxy]phenol (PubChem CID 54299691) has the molecular formula C16H13Cl3O2 and a molecular weight of 343.64 g/mol. Its IUPAC name is 3,5-dichloro-4-[4-(4-chlorophenyl)but-3-enoxy]phenol.
| Compound Name | 3,5-dichloro-4-[4-(4-chlorophenyl)but-3-enoxy]phenol |
|---|---|
| PubChem CID | 54299691 |
| Molecular Formula | C16H13Cl3O2 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3,5-dichloro-4-[4-(4-chlorophenyl)but-3-enoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCCC=Cc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl3O2/c17-12-6-4-11(5-7-12)3-1-2-8-21-16-14(18)9-13(20)10-15(16)19/h1,3-7,9-10,20H,2,8H2 |
| InChIKey | SDHZWVZNVGHUGV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|