C37H41ClNO2+ — CID 10372040
3-[(E)-2-[1-[10-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenoxy]decyl]pyridin-1-ium-4-yl]ethenyl]phenol (PubChem CID 10372040) has the molecular formula C37H41ClNO2+ and a molecular weight of 567.19 g/mol. Its IUPAC name is 3-[(E)-2-[1-[10-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenoxy]decyl]pyridin-1-ium-4-yl]ethenyl]phenol.
| Compound Name | 3-[(E)-2-[1-[10-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenoxy]decyl]pyridin-1-ium-4-yl]ethenyl]phenol |
|---|---|
| PubChem CID | 10372040 |
| Molecular Formula | C37H41ClNO2+ |
| Molecular Weight | 567.19 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 3-[(E)-2-[1-[10-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenoxy]decyl]pyridin-1-ium-4-yl]ethenyl]phenol |
| SMILES | Oc1cccc(/C=C/c2cc[n+](CCCCCCCCCCOc3ccc(/C=C/c4ccc(Cl)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C37H40ClNO2/c38-35-20-16-31(17-21-35)12-13-32-18-22-37(23-19-32)41-29-8-6-4-2-1-3-5-7-26-39-27-24-33(25-28-39)14-15-34-10-9-11-36(40)30-34/h9-25,27-28,30H,1-8,26,29H2/p+1/b13-12+,15-14+ |
| InChIKey | GTHVARQBJCOJNB-SQIWNDBBSA-O |
| XLogP | 9.87 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.19 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|