C15H14NO3+ — CID 13067982
2-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid (PubChem CID 13067982) has the molecular formula C15H14NO3+ and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 13067982 |
| Molecular Formula | C15H14NO3+ |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid |
| SMILES | O=C(O)C[n+]1ccc(/C=C/c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C15H13NO3/c17-14-3-1-2-13(10-14)5-4-12-6-8-16(9-7-12)11-15(18)19/h1-10H,11H2,(H-,17,18,19)/p+1/b5-4+ |
| InChIKey | LTOGXJRWGBRSRE-SNAWJCMRSA-O |
| XLogP | 1.93 |
| TPSA | 61.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|