C16H14NO5+ — CID 22381076
3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoic acid (PubChem CID 22381076) has the molecular formula C16H14NO5+ and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoic acid.
| Compound Name | 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 22381076 |
| Molecular Formula | C16H14NO5+ |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)C[n+]1ccc(/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H13NO5/c18-13-4-3-12(9-14(13)19)2-1-11-5-7-17(8-6-11)10-15(20)16(21)22/h1-9H,10H2,(H2,19,21,22)/p+1 |
| InChIKey | CNQKBVLEMTWPEI-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|