C18H18NO5+ — CID 22381083
ethyl 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoate (PubChem CID 22381083) has the molecular formula C18H18NO5+ and a molecular weight of 328.34 g/mol. Its IUPAC name is ethyl 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoate.
| Compound Name | ethyl 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoate |
|---|---|
| PubChem CID | 22381083 |
| Molecular Formula | C18H18NO5+ |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethyl 3-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)C[n+]1ccc(/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-2-24-18(23)17(22)12-19-9-7-13(8-10-19)3-4-14-5-6-15(20)16(21)11-14/h3-11,21H,2,12H2,1H3/p+1 |
| InChIKey | ZIHKLWFGBKTLRP-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|