C21H16BrCl2NO — CID 45123596
1-(2,4-dichlorophenyl)-2-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]ethanone bromide (PubChem CID 45123596) has the molecular formula C21H16BrCl2NO and a molecular weight of 449.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(2,4-dichlorophenyl)-2-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 45123596 |
| Molecular Formula | C21H16BrCl2NO |
| Molecular Weight | 449.18 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]ethanone bromide |
| SMILES | O=C(C[n+]1ccc(/C=C/c2ccccc2)cc1)c1ccc(Cl)cc1Cl.[Br-] |
| InChI | InChI=1S/C21H16Cl2NO.BrH/c22-18-8-9-19(20(23)14-18)21(25)15-24-12-10-17(11-13-24)7-6-16-4-2-1-3-5-16;/h1-14H,15H2;1H/q+1;/p-1/b7-6+; |
| InChIKey | ZEICHXKVCKTRBZ-UHDJGPCESA-M |
| XLogP | 2.34 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|