C15H13Cl2N2O2+ — CID 170860165
2-amino-1-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-1-ium-3-yl]ethanone (PubChem CID 170860165) has the molecular formula C15H13Cl2N2O2+ and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-amino-1-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-1-ium-3-yl]ethanone.
| Compound Name | 2-amino-1-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-1-ium-3-yl]ethanone |
|---|---|
| PubChem CID | 170860165 |
| Molecular Formula | C15H13Cl2N2O2+ |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-amino-1-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-1-ium-3-yl]ethanone |
| SMILES | NCC(=O)c1ccc[n+](CC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N2O2/c16-11-3-4-12(13(17)6-11)15(21)9-19-5-1-2-10(8-19)14(20)7-18/h1-6,8H,7,9,18H2/q+1 |
| InChIKey | MVZAKJYDDMHHFF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|