C14H13Cl3NO+ — CID 126958639
1-(2,4-dichlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethanone;hydrochloride (PubChem CID 126958639) has the molecular formula C14H13Cl3NO+ and a molecular weight of 317.62 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethanone;hydrochloride.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 126958639 |
| Molecular Formula | C14H13Cl3NO+ |
| Molecular Weight | 317.62 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethanone;hydrochloride |
| SMILES | Cc1cc[n+](CC(=O)c2ccc(Cl)cc2Cl)cc1.Cl |
| InChI | InChI=1S/C14H12Cl2NO.ClH/c1-10-4-6-17(7-5-10)9-14(18)12-3-2-11(15)8-13(12)16;/h2-8H,9H2,1H3;1H/q+1; |
| InChIKey | KDFNQLWEIMWAGN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|