C13H12Cl2NOS+ — CID 21078935
1-(2,4-dichlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone (PubChem CID 21078935) has the molecular formula C13H12Cl2NOS+ and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 21078935 |
| Molecular Formula | C13H12Cl2NOS+ |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone |
| SMILES | Cc1sc[n+](CC(=O)c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C13H12Cl2NOS/c1-8-9(2)18-7-16(8)6-13(17)11-4-3-10(14)5-12(11)15/h3-5,7H,6H2,1-2H3/q+1 |
| InChIKey | RTXJWKUAVIFTHY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|