C13H18Cl3NO — CID 62572065
N-propan-2-yl-4-(2,4,6-trichlorophenoxy)butan-1-amine (PubChem CID 62572065) has the molecular formula C13H18Cl3NO and a molecular weight of 310.65 g/mol. Its IUPAC name is N-propan-2-yl-4-(2,4,6-trichlorophenoxy)butan-1-amine.
| Compound Name | N-propan-2-yl-4-(2,4,6-trichlorophenoxy)butan-1-amine |
|---|---|
| PubChem CID | 62572065 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-propan-2-yl-4-(2,4,6-trichlorophenoxy)butan-1-amine |
| SMILES | CC(C)NCCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3NO/c1-9(2)17-5-3-4-6-18-13-11(15)7-10(14)8-12(13)16/h7-9,17H,3-6H2,1-2H3 |
| InChIKey | VKCHYZRFIKSDBT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|