C13H18Cl3NO2 — CID 2280812
N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]propan-2-amine (PubChem CID 2280812) has the molecular formula C13H18Cl3NO2 and a molecular weight of 326.65 g/mol. Its IUPAC name is N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]propan-2-amine.
| Compound Name | N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 2280812 |
| Molecular Formula | C13H18Cl3NO2 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]propan-2-amine |
| SMILES | CC(C)NCCOCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3NO2/c1-9(2)17-3-4-18-5-6-19-13-11(15)7-10(14)8-12(13)16/h7-9,17H,3-6H2,1-2H3 |
| InChIKey | ACOJWZGCSWQEKP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|