C13H20N2 — CID 115226180
N'-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]-N'-methylmethanediamine (PubChem CID 115226180) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]-N'-methylmethanediamine.
| Compound Name | N'-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]-N'-methylmethanediamine |
|---|---|
| PubChem CID | 115226180 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N'-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]-N'-methylmethanediamine |
| SMILES | CN(CN)CCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H20N2/c1-15(10-14)8-7-11-5-6-12-3-2-4-13(12)9-11/h5-6,9H,2-4,7-8,10,14H2,1H3 |
| InChIKey | YGXNKBSKCVSKIE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|