C13H19NO — CID 115229439
[2-(2,3-dihydro-1H-inden-5-yl)ethyl-methylamino]methanol (PubChem CID 115229439) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yl)ethyl-methylamino]methanol.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yl)ethyl-methylamino]methanol |
|---|---|
| PubChem CID | 115229439 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yl)ethyl-methylamino]methanol |
| SMILES | CN(CO)CCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H19NO/c1-14(10-15)8-7-11-5-6-12-3-2-4-13(12)9-11/h5-6,9,15H,2-4,7-8,10H2,1H3 |
| InChIKey | RYMQHUBBRWUFOQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|