C16H25NO3 — CID 143068293
tert-butyl carbamate;5,6,7,8-tetrahydronaphthalen-2-ylmethanol (PubChem CID 143068293) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl carbamate;5,6,7,8-tetrahydronaphthalen-2-ylmethanol.
| Compound Name | tert-butyl carbamate;5,6,7,8-tetrahydronaphthalen-2-ylmethanol |
|---|---|
| PubChem CID | 143068293 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl carbamate;5,6,7,8-tetrahydronaphthalen-2-ylmethanol |
| SMILES | CC(C)(C)OC(N)=O.OCc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H14O.C5H11NO2/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-5(2,3)8-4(6)7/h5-7,12H,1-4,8H2;1-3H3,(H2,6,7) |
| InChIKey | NRFGYBDNOHHCEI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |