C16H23NO3 — CID 143068294
tert-butyl carbamate;5,6,7,8-tetrahydronaphthalene-2-carbaldehyde (PubChem CID 143068294) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl carbamate;5,6,7,8-tetrahydronaphthalene-2-carbaldehyde.
| Compound Name | tert-butyl carbamate;5,6,7,8-tetrahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 143068294 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl carbamate;5,6,7,8-tetrahydronaphthalene-2-carbaldehyde |
| SMILES | CC(C)(C)OC(N)=O.O=Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H12O.C5H11NO2/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-5(2,3)8-4(6)7/h5-8H,1-4H2;1-3H3,(H2,6,7) |
| InChIKey | PBQHCZJVFSSWCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|