C14H20N2O2 — CID 115240823
2-amino-3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoic acid (PubChem CID 115240823) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-amino-3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoic acid.
| Compound Name | 2-amino-3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 115240823 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-amino-3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoic acid |
| SMILES | NC(CNCCc1ccc2c(c1)CCC2)C(=O)O |
| InChI | InChI=1S/C14H20N2O2/c15-13(14(17)18)9-16-7-6-10-4-5-11-2-1-3-12(11)8-10/h4-5,8,13,16H,1-3,6-7,9,15H2,(H,17,18) |
| InChIKey | QYJGGSFHCSKYGJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|