C15H22N2O2 — CID 115240814
2-amino-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]propanoic acid (PubChem CID 115240814) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-amino-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]propanoic acid.
| Compound Name | 2-amino-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 115240814 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-amino-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]propanoic acid |
| SMILES | NC(CNCCc1ccc2c(c1)CCCC2)C(=O)O |
| InChI | InChI=1S/C15H22N2O2/c16-14(15(18)19)10-17-8-7-11-5-6-12-3-1-2-4-13(12)9-11/h5-6,9,14,17H,1-4,7-8,10,16H2,(H,18,19) |
| InChIKey | GUZFCSXBPUGOBU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|